| Name | Vinyl stearate |
| Synonyms | Vinyl stearate ethenyl octadecanoate Stearic Acid Vinyl Ester (stabilized with MEHQ) |
| CAS | 111-63-7 |
| EINECS | 203-890-0 |
| InChI | InChI=1/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h4H,2-3,5-19H2,1H3 |
| Molecular Formula | C20H38O2 |
| Molar Mass | 310.51 |
| Density | 0.869g/cm3 |
| Melting Point | 35-185℃ |
| Boling Point | 385.1°C at 760 mmHg |
| Flash Point | 138.6°C |
| Vapor Presure | 3.91E-06mmHg at 25°C |
| Storage Condition | 2-8°C |
| Stability | Stable. Incompatible with acids, bases, strong oxidizing agents. |
| Refractive Index | 1.451 |
| MDL | MFCD00026667 |
| Physical and Chemical Properties | EPA Chemical Information Octadecanoic acid, ethenyl ester (111-63-7) |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Raw Materials | FUMING SULFURIC ACID Stearic acid Sodium acetate trihydrate Vinyl acetate MERCURIC ACETATE |
| Downstream Products | 2-aminoethyl stearate STEAROYL ETHANOLAMIDE |
| Specific gravity | 0.904 |